C25H25F3O2 — CID 155931325
4-[1-(3-ethyl-4-hydroxy-5-methylphenyl)-2,2,2-trifluoro-1-phenylethyl]-2,6-dimethylphenol (PubChem CID 155931325) has the molecular formula C25H25F3O2 and a molecular weight of 414.47 g/mol. Its IUPAC name is 4-[1-(3-ethyl-4-hydroxy-5-methylphenyl)-2,2,2-trifluoro-1-phenylethyl]-2,6-dimethylphenol.
| Compound Name | 4-[1-(3-ethyl-4-hydroxy-5-methylphenyl)-2,2,2-trifluoro-1-phenylethyl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 155931325 |
| Molecular Formula | C25H25F3O2 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 4-[1-(3-ethyl-4-hydroxy-5-methylphenyl)-2,2,2-trifluoro-1-phenylethyl]-2,6-dimethylphenol |
| SMILES | CCc1cc(C(c2ccccc2)(c2cc(C)c(O)c(C)c2)C(F)(F)F)cc(C)c1O |
| InChI | InChI=1S/C25H25F3O2/c1-5-18-14-21(13-17(4)23(18)30)24(25(26,27)28,19-9-7-6-8-10-19)20-11-15(2)22(29)16(3)12-20/h6-14,29-30H,5H2,1-4H3 |
| InChIKey | IJLAVQUGLLZUNT-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|