C36H29F5O6S2 — CID 161011073
[2,6-dimethyl-4-[2,2,2-trifluoro-1-[4-(4-fluorophenyl)sulfonyloxy-3,5-dimethylphenyl]-1-phenylethyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 161011073) has the molecular formula C36H29F5O6S2 and a molecular weight of 716.75 g/mol. Its IUPAC name is [2,6-dimethyl-4-[2,2,2-trifluoro-1-[4-(4-fluorophenyl)sulfonyloxy-3,5-dimethylphenyl]-1-phenylethyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [2,6-dimethyl-4-[2,2,2-trifluoro-1-[4-(4-fluorophenyl)sulfonyloxy-3,5-dimethylphenyl]-1-phenylethyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 161011073 |
| Molecular Formula | C36H29F5O6S2 |
| Molecular Weight | 716.75 g/mol |
| Exact Mass | 716.13 |
| IUPAC Name | [2,6-dimethyl-4-[2,2,2-trifluoro-1-[4-(4-fluorophenyl)sulfonyloxy-3,5-dimethylphenyl]-1-phenylethyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | Cc1cc(C(c2ccccc2)(c2cc(C)c(OS(=O)(=O)c3ccc(F)cc3)c(C)c2)C(F)(F)F)cc(C)c1OS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C36H29F5O6S2/c1-22-18-27(19-23(2)33(22)46-48(42,43)31-14-10-29(37)11-15-31)35(36(39,40)41,26-8-6-5-7-9-26)28-20-24(3)34(25(4)21-28)47-49(44,45)32-16-12-30(38)13-17-32/h5-21H,1-4H3 |
| InChIKey | TXCVNKVIEIMOPP-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.75 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|