C15H14F2O3S — CID 30325883
(2,4,6-trimethylphenyl) 2,6-difluorobenzenesulfonate (PubChem CID 30325883) has the molecular formula C15H14F2O3S and a molecular weight of 312.34 g/mol. Its IUPAC name is (2,4,6-trimethylphenyl) 2,6-difluorobenzenesulfonate.
| Compound Name | (2,4,6-trimethylphenyl) 2,6-difluorobenzenesulfonate |
|---|---|
| PubChem CID | 30325883 |
| Molecular Formula | C15H14F2O3S |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | (2,4,6-trimethylphenyl) 2,6-difluorobenzenesulfonate |
| SMILES | Cc1cc(C)c(OS(=O)(=O)c2c(F)cccc2F)c(C)c1 |
| InChI | InChI=1S/C15H14F2O3S/c1-9-7-10(2)14(11(3)8-9)20-21(18,19)15-12(16)5-4-6-13(15)17/h4-8H,1-3H3 |
| InChIKey | GLWCUILLMZCWRM-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|