C15H11FO — CID 82579551
5-fluoro-1,3-dimethylfluoren-9-one (PubChem CID 82579551) has the molecular formula C15H11FO and a molecular weight of 226.25 g/mol. Its IUPAC name is 5-fluoro-1,3-dimethylfluoren-9-one.
| Compound Name | 5-fluoro-1,3-dimethylfluoren-9-one |
|---|---|
| PubChem CID | 82579551 |
| Molecular Formula | C15H11FO |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 5-fluoro-1,3-dimethylfluoren-9-one |
| SMILES | Cc1cc(C)c2c(c1)-c1c(F)cccc1C2=O |
| InChI | InChI=1S/C15H11FO/c1-8-6-9(2)13-11(7-8)14-10(15(13)17)4-3-5-12(14)16/h3-7H,1-2H3 |
| InChIKey | HSFUSQHBFRKZGZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |