C48H52N2Ni — CID 139137061
bis([2,6-bis(2,4,6-trimethylphenyl)phenyl]azanide);nickel(2+) (PubChem CID 139137061) has the molecular formula C48H52N2Ni and a molecular weight of 715.65 g/mol. Its IUPAC name is bis([2,6-bis(2,4,6-trimethylphenyl)phenyl]azanide);nickel(2+).
| Compound Name | bis([2,6-bis(2,4,6-trimethylphenyl)phenyl]azanide);nickel(2+) |
|---|---|
| PubChem CID | 139137061 |
| Molecular Formula | C48H52N2Ni |
| Molecular Weight | 715.65 g/mol |
| Exact Mass | 714.35 |
| IUPAC Name | bis([2,6-bis(2,4,6-trimethylphenyl)phenyl]azanide);nickel(2+) |
| SMILES | Cc1cc(C)c(-c2cccc(-c3c(C)cc(C)cc3C)c2[NH-])c(C)c1.Cc1cc(C)c(-c2cccc(-c3c(C)cc(C)cc3C)c2[NH-])c(C)c1.[Ni+2] |
| InChI | InChI=1S/2C24H26N.Ni/c2*1-14-10-16(3)22(17(4)11-14)20-8-7-9-21(24(20)25)23-18(5)12-15(2)13-19(23)6;/h2*7-13,25H,1-6H3;/q2*-1;+2 |
| InChIKey | AVLWOFLHFQMIHX-UHFFFAOYSA-N |
| XLogP | 15.11 |
| TPSA | 47.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.65 |
| LogP ≤ 5 | 15.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |