C27H34LiNSi — CID 101398380
lithium [2,6-bis(2,4,6-trimethylphenyl)phenyl]-trimethylsilylazanide (PubChem CID 101398380) has the molecular formula C27H34LiNSi and a molecular weight of 407.60 g/mol. Its IUPAC name is lithium [2,6-bis(2,4,6-trimethylphenyl)phenyl]-trimethylsilylazanide.
| Compound Name | lithium [2,6-bis(2,4,6-trimethylphenyl)phenyl]-trimethylsilylazanide |
|---|---|
| PubChem CID | 101398380 |
| Molecular Formula | C27H34LiNSi |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | lithium [2,6-bis(2,4,6-trimethylphenyl)phenyl]-trimethylsilylazanide |
| SMILES | Cc1cc(C)c(-c2cccc(-c3c(C)cc(C)cc3C)c2[N-][Si](C)(C)C)c(C)c1.[Li+] |
| InChI | InChI=1S/C27H34NSi.Li/c1-17-13-19(3)25(20(4)14-17)23-11-10-12-24(27(23)28-29(7,8)9)26-21(5)15-18(2)16-22(26)6;/h10-16H,1-9H3;/q-1;+1 |
| InChIKey | XCMPEPUXSKFGLR-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|