C12H20LiNSi — CID 12699524
lithium (2,4,6-trimethylphenyl)-trimethylsilylazanide (PubChem CID 12699524) has the molecular formula C12H20LiNSi and a molecular weight of 213.33 g/mol. Its IUPAC name is lithium (2,4,6-trimethylphenyl)-trimethylsilylazanide.
| Compound Name | lithium (2,4,6-trimethylphenyl)-trimethylsilylazanide |
|---|---|
| PubChem CID | 12699524 |
| Molecular Formula | C12H20LiNSi |
| Molecular Weight | 213.33 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | lithium (2,4,6-trimethylphenyl)-trimethylsilylazanide |
| SMILES | Cc1cc(C)c([N-][Si](C)(C)C)c(C)c1.[Li+] |
| InChI | InChI=1S/C12H20NSi.Li/c1-9-7-10(2)12(11(3)8-9)13-14(4,5)6;/h7-8H,1-6H3;/q-1;+1 |
| InChIKey | QUOIZKYUDIEWGD-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.33 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|