C9H11Se- — CID 13099944
2,4,6-trimethylbenzeneselenolate (PubChem CID 13099944) has the molecular formula C9H11Se- and a molecular weight of 198.15 g/mol. Its IUPAC name is 2,4,6-trimethylbenzeneselenolate.
| Compound Name | 2,4,6-trimethylbenzeneselenolate |
|---|---|
| PubChem CID | 13099944 |
| Molecular Formula | C9H11Se- |
| Molecular Weight | 198.15 g/mol |
| Exact Mass | 199.00 |
| IUPAC Name | 2,4,6-trimethylbenzeneselenolate |
| SMILES | Cc1cc(C)c([Se-])c(C)c1 |
| InChI | InChI=1S/C9H12Se/c1-6-4-7(2)9(10)8(3)5-6/h4-5,10H,1-3H3/p-1 |
| InChIKey | GROORNXKUUGAIJ-UHFFFAOYSA-M |
| XLogP | 1.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.15 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|