C18H22Te — CID 11783500
1,3,5-trimethyl-2-(2,4,6-trimethylphenyl)tellanylbenzene (PubChem CID 11783500) has the molecular formula C18H22Te and a molecular weight of 365.97 g/mol. Its IUPAC name is 1,3,5-trimethyl-2-(2,4,6-trimethylphenyl)tellanylbenzene.
| Compound Name | 1,3,5-trimethyl-2-(2,4,6-trimethylphenyl)tellanylbenzene |
|---|---|
| PubChem CID | 11783500 |
| Molecular Formula | C18H22Te |
| Molecular Weight | 365.97 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 1,3,5-trimethyl-2-(2,4,6-trimethylphenyl)tellanylbenzene |
| SMILES | Cc1cc(C)c([Te]c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C18H22Te/c1-11-7-13(3)17(14(4)8-11)19-18-15(5)9-12(2)10-16(18)6/h7-10H,1-6H3 |
| InChIKey | XMTOAYAZNFIISX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.97 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|