C24H25Se- — CID 132518583
2,6-bis(2,4,6-trimethylphenyl)benzeneselenolate (PubChem CID 132518583) has the molecular formula C24H25Se- and a molecular weight of 392.42 g/mol. Its IUPAC name is 2,6-bis(2,4,6-trimethylphenyl)benzeneselenolate.
| Compound Name | 2,6-bis(2,4,6-trimethylphenyl)benzeneselenolate |
|---|---|
| PubChem CID | 132518583 |
| Molecular Formula | C24H25Se- |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 2,6-bis(2,4,6-trimethylphenyl)benzeneselenolate |
| SMILES | Cc1cc(C)c(-c2cccc(-c3c(C)cc(C)cc3C)c2[Se-])c(C)c1 |
| InChI | InChI=1S/C24H26Se/c1-14-10-16(3)22(17(4)11-14)20-8-7-9-21(24(20)25)23-18(5)12-15(2)13-19(23)6/h7-13,25H,1-6H3/p-1 |
| InChIKey | WHWDLZVTLGJXFM-UHFFFAOYSA-M |
| XLogP | 5.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|