C25H25CuS2 — CID 132518578
2,6-bis(2,4,6-trimethylphenyl)benzenecarbodithioate;copper(1+) (PubChem CID 132518578) has the molecular formula C25H25CuS2 and a molecular weight of 453.16 g/mol. Its IUPAC name is 2,6-bis(2,4,6-trimethylphenyl)benzenecarbodithioate;copper(1+).
| Compound Name | 2,6-bis(2,4,6-trimethylphenyl)benzenecarbodithioate;copper(1+) |
|---|---|
| PubChem CID | 132518578 |
| Molecular Formula | C25H25CuS2 |
| Molecular Weight | 453.16 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 2,6-bis(2,4,6-trimethylphenyl)benzenecarbodithioate;copper(1+) |
| SMILES | Cc1cc(C)c(-c2cccc(-c3c(C)cc(C)cc3C)c2C(=S)[S-])c(C)c1.[Cu+] |
| InChI | InChI=1S/C25H26S2.Cu/c1-14-10-16(3)22(17(4)11-14)20-8-7-9-21(24(20)25(26)27)23-18(5)12-15(2)13-19(23)6;/h7-13H,1-6H3,(H,26,27);/q;+1/p-1 |
| InChIKey | IJRJTFJTDPTSBR-UHFFFAOYSA-M |
| XLogP | 7.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.16 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|