C17H20O — CID 132576602
2-ethyl-6-(2,4,6-trimethylphenyl)phenol (PubChem CID 132576602) has the molecular formula C17H20O and a molecular weight of 240.35 g/mol. Its IUPAC name is 2-ethyl-6-(2,4,6-trimethylphenyl)phenol.
| Compound Name | 2-ethyl-6-(2,4,6-trimethylphenyl)phenol |
|---|---|
| PubChem CID | 132576602 |
| Molecular Formula | C17H20O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 2-ethyl-6-(2,4,6-trimethylphenyl)phenol |
| SMILES | CCc1cccc(-c2c(C)cc(C)cc2C)c1O |
| InChI | InChI=1S/C17H20O/c1-5-14-7-6-8-15(17(14)18)16-12(3)9-11(2)10-13(16)4/h6-10,18H,5H2,1-4H3 |
| InChIKey | JJVCYOXBWNZVJQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |