C38H46O4 — CID 164911928
(3R,4R)-2,5-bis[2-hydroxy-3-(2,4,6-trimethylphenyl)phenyl]-2,5-dimethylhexane-3,4-diol (PubChem CID 164911928) has the molecular formula C38H46O4 and a molecular weight of 566.78 g/mol. Its IUPAC name is (3R,4R)-2,5-bis[2-hydroxy-3-(2,4,6-trimethylphenyl)phenyl]-2,5-dimethylhexane-3,4-diol.
| Compound Name | (3R,4R)-2,5-bis[2-hydroxy-3-(2,4,6-trimethylphenyl)phenyl]-2,5-dimethylhexane-3,4-diol |
|---|---|
| PubChem CID | 164911928 |
| Molecular Formula | C38H46O4 |
| Molecular Weight | 566.78 g/mol |
| Exact Mass | 566.34 |
| IUPAC Name | (3R,4R)-2,5-bis[2-hydroxy-3-(2,4,6-trimethylphenyl)phenyl]-2,5-dimethylhexane-3,4-diol |
| SMILES | Cc1cc(C)c(-c2cccc(C(C)(C)[C@@H](O)[C@H](O)C(C)(C)c3cccc(-c4c(C)cc(C)cc4C)c3O)c2O)c(C)c1 |
| InChI | InChI=1S/C38H46O4/c1-21-17-23(3)31(24(4)18-21)27-13-11-15-29(33(27)39)37(7,8)35(41)36(42)38(9,10)30-16-12-14-28(34(30)40)32-25(5)19-22(2)20-26(32)6/h11-20,35-36,39-42H,1-10H3/t35-,36-/m0/s1 |
| InChIKey | YVQKYXQACMXYHM-ZPGRZCPFSA-N |
| XLogP | 8.26 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.78 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |