C25H25O2- — CID 102375892
2,6-bis(2,4,6-trimethylphenyl)benzoate (PubChem CID 102375892) has the molecular formula C25H25O2- and a molecular weight of 357.47 g/mol. Its IUPAC name is 2,6-bis(2,4,6-trimethylphenyl)benzoate.
| Compound Name | 2,6-bis(2,4,6-trimethylphenyl)benzoate |
|---|---|
| PubChem CID | 102375892 |
| Molecular Formula | C25H25O2- |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 2,6-bis(2,4,6-trimethylphenyl)benzoate |
| SMILES | Cc1cc(C)c(-c2cccc(-c3c(C)cc(C)cc3C)c2C(=O)[O-])c(C)c1 |
| InChI | InChI=1S/C25H26O2/c1-14-10-16(3)22(17(4)11-14)20-8-7-9-21(24(20)25(26)27)23-18(5)12-15(2)13-19(23)6/h7-13H,1-6H3,(H,26,27)/p-1 |
| InChIKey | DNDIBAYNLKBGLO-UHFFFAOYSA-M |
| XLogP | 5.23 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |