C21H23O3S2- — CID 174726778
hydrogen sulfite;sulfane;1,3,5-trimethyl-2-(2-phenylphenyl)benzene (PubChem CID 174726778) has the molecular formula C21H23O3S2- and a molecular weight of 387.55 g/mol. Its IUPAC name is hydrogen sulfite;sulfane;1,3,5-trimethyl-2-(2-phenylphenyl)benzene.
| Compound Name | hydrogen sulfite;sulfane;1,3,5-trimethyl-2-(2-phenylphenyl)benzene |
|---|---|
| PubChem CID | 174726778 |
| Molecular Formula | C21H23O3S2- |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | hydrogen sulfite;sulfane;1,3,5-trimethyl-2-(2-phenylphenyl)benzene |
| SMILES | Cc1cc(C)c(-c2ccccc2-c2ccccc2)c(C)c1.O=S([O-])O.S |
| InChI | InChI=1S/C21H20.H2O3S.H2S/c1-15-13-16(2)21(17(3)14-15)20-12-8-7-11-19(20)18-9-5-4-6-10-18;1-4(2)3;/h4-14H,1-3H3;(H2,1,2,3);1H2/p-1 |
| InChIKey | SUOANXNRBGBKKF-UHFFFAOYSA-M |
| XLogP | 5.40 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|