C28H26O3S — CID 87124199
4-methyl-2,6-diphenyl-3-(2,4,6-trimethylphenyl)benzenesulfonic acid (PubChem CID 87124199) has the molecular formula C28H26O3S and a molecular weight of 442.58 g/mol. Its IUPAC name is 4-methyl-2,6-diphenyl-3-(2,4,6-trimethylphenyl)benzenesulfonic acid.
| Compound Name | 4-methyl-2,6-diphenyl-3-(2,4,6-trimethylphenyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 87124199 |
| Molecular Formula | C28H26O3S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 4-methyl-2,6-diphenyl-3-(2,4,6-trimethylphenyl)benzenesulfonic acid |
| SMILES | Cc1cc(C)c(-c2c(C)cc(-c3ccccc3)c(S(=O)(=O)O)c2-c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C28H26O3S/c1-18-15-19(2)25(20(3)16-18)26-21(4)17-24(22-11-7-5-8-12-22)28(32(29,30)31)27(26)23-13-9-6-10-14-23/h5-17H,1-4H3,(H,29,30,31) |
| InChIKey | WDWBODJTMIINFA-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|