C27H26O3S2 — CID 173224409
2,4-dimethyl-3,5-diphenylbenzenethiol;4-methylbenzenesulfonic acid (PubChem CID 173224409) has the molecular formula C27H26O3S2 and a molecular weight of 462.64 g/mol. Its IUPAC name is 2,4-dimethyl-3,5-diphenylbenzenethiol;4-methylbenzenesulfonic acid.
| Compound Name | 2,4-dimethyl-3,5-diphenylbenzenethiol;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 173224409 |
| Molecular Formula | C27H26O3S2 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | 2,4-dimethyl-3,5-diphenylbenzenethiol;4-methylbenzenesulfonic acid |
| SMILES | Cc1c(S)cc(-c2ccccc2)c(C)c1-c1ccccc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C20H18S.C7H8O3S/c1-14-18(16-9-5-3-6-10-16)13-19(21)15(2)20(14)17-11-7-4-8-12-17;1-6-2-4-7(5-3-6)11(8,9)10/h3-13,21H,1-2H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | SFNOVOGMRISSJI-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|