C48H34O6S2 — CID 168764295
4-[3-[4-[2,3-diphenyl-6-(4-sulfophenyl)phenyl]phenyl]-4-phenylphenyl]benzenesulfonic acid (PubChem CID 168764295) has the molecular formula C48H34O6S2 and a molecular weight of 770.93 g/mol. Its IUPAC name is 4-[3-[4-[2,3-diphenyl-6-(4-sulfophenyl)phenyl]phenyl]-4-phenylphenyl]benzenesulfonic acid.
| Compound Name | 4-[3-[4-[2,3-diphenyl-6-(4-sulfophenyl)phenyl]phenyl]-4-phenylphenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 168764295 |
| Molecular Formula | C48H34O6S2 |
| Molecular Weight | 770.93 g/mol |
| Exact Mass | 770.18 |
| IUPAC Name | 4-[3-[4-[2,3-diphenyl-6-(4-sulfophenyl)phenyl]phenyl]-4-phenylphenyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(-c2ccc(-c3ccccc3)c(-c3ccc(-c4c(-c5ccc(S(=O)(=O)O)cc5)ccc(-c5ccccc5)c4-c4ccccc4)cc3)c2)cc1 |
| InChI | InChI=1S/C48H34O6S2/c49-55(50,51)41-25-20-33(21-26-41)40-24-29-43(34-10-4-1-5-11-34)46(32-40)37-16-18-39(19-17-37)48-45(36-22-27-42(28-23-36)56(52,53)54)31-30-44(35-12-6-2-7-13-35)47(48)38-14-8-3-9-15-38/h1-32H,(H,49,50,51)(H,52,53,54) |
| InChIKey | FGQUMDTVDOAZDY-UHFFFAOYSA-N |
| XLogP | 11.85 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.93 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|