C26H24O3S2 — CID 173224580
4-methylbenzenesulfonic acid;2-methyl-3,4-diphenylbenzenethiol (PubChem CID 173224580) has the molecular formula C26H24O3S2 and a molecular weight of 448.61 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;2-methyl-3,4-diphenylbenzenethiol.
| Compound Name | 4-methylbenzenesulfonic acid;2-methyl-3,4-diphenylbenzenethiol |
|---|---|
| PubChem CID | 173224580 |
| Molecular Formula | C26H24O3S2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 4-methylbenzenesulfonic acid;2-methyl-3,4-diphenylbenzenethiol |
| SMILES | Cc1c(S)ccc(-c2ccccc2)c1-c1ccccc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C19H16S.C7H8O3S/c1-14-18(20)13-12-17(15-8-4-2-5-9-15)19(14)16-10-6-3-7-11-16;1-6-2-4-7(5-3-6)11(8,9)10/h2-13,20H,1H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | NHKRUKIZBQLHSB-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|