C78H70 — CID 135033708
1,4-diphenyl-2,3,5,6-tetrakis[4-(2,4,6-trimethylphenyl)phenyl]benzene (PubChem CID 135033708) has the molecular formula C78H70 and a molecular weight of 1007.42 g/mol. Its IUPAC name is 1,4-diphenyl-2,3,5,6-tetrakis[4-(2,4,6-trimethylphenyl)phenyl]benzene.
| Compound Name | 1,4-diphenyl-2,3,5,6-tetrakis[4-(2,4,6-trimethylphenyl)phenyl]benzene |
|---|---|
| PubChem CID | 135033708 |
| Molecular Formula | C78H70 |
| Molecular Weight | 1007.42 g/mol |
| Exact Mass | 1006.55 |
| IUPAC Name | 1,4-diphenyl-2,3,5,6-tetrakis[4-(2,4,6-trimethylphenyl)phenyl]benzene |
| SMILES | Cc1cc(C)c(-c2ccc(-c3c(-c4ccccc4)c(-c4ccc(-c5c(C)cc(C)cc5C)cc4)c(-c4ccc(-c5c(C)cc(C)cc5C)cc4)c(-c4ccccc4)c3-c3ccc(-c4c(C)cc(C)cc4C)cc3)cc2)c(C)c1 |
| InChI | InChI=1S/C78H70/c1-47-39-51(5)69(52(6)40-47)61-23-31-65(32-24-61)75-73(59-19-15-13-16-20-59)77(67-35-27-63(28-36-67)71-55(9)43-49(3)44-56(71)10)78(68-37-29-64(30-38-68)72-57(11)45-50(4)46-58(72)12)74(60-21-17-14-18-22-60)76(75)66-33-25-62(26-34-66)70-53(7)41-48(2)42-54(70)8/h13-46H,1-12H3 |
| InChIKey | YKACBJXBIBOXML-UHFFFAOYSA-N |
| XLogP | 22.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1007.42 |
| LogP ≤ 5 | 22.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |