C49H42 — CID 162426532
2,3,8-trimethyl-12-(4-methylphenyl)-5,11-diphenyl-6-(2,4,6-trimethylphenyl)tetracene (PubChem CID 162426532) has the molecular formula C49H42 and a molecular weight of 630.88 g/mol. Its IUPAC name is 2,3,8-trimethyl-12-(4-methylphenyl)-5,11-diphenyl-6-(2,4,6-trimethylphenyl)tetracene.
| Compound Name | 2,3,8-trimethyl-12-(4-methylphenyl)-5,11-diphenyl-6-(2,4,6-trimethylphenyl)tetracene |
|---|---|
| PubChem CID | 162426532 |
| Molecular Formula | C49H42 |
| Molecular Weight | 630.88 g/mol |
| Exact Mass | 630.33 |
| IUPAC Name | 2,3,8-trimethyl-12-(4-methylphenyl)-5,11-diphenyl-6-(2,4,6-trimethylphenyl)tetracene |
| SMILES | Cc1ccc(-c2c3cc(C)c(C)cc3c(-c3ccccc3)c3c(-c4c(C)cc(C)cc4C)c4cc(C)ccc4c(-c4ccccc4)c23)cc1 |
| InChI | InChI=1S/C49H42/c1-29-18-21-38(22-19-29)46-42-28-33(5)32(4)27-41(42)45(37-16-12-9-13-17-37)49-47(43-34(6)24-31(3)25-35(43)7)40-26-30(2)20-23-39(40)44(48(46)49)36-14-10-8-11-15-36/h8-28H,1-7H3 |
| InChIKey | NCJFQXVOZILJKL-UHFFFAOYSA-N |
| XLogP | 13.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.88 |
| LogP ≤ 5 | 13.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|