C61H66 — CID 162426404
5,6,11,12-tetrakis(4-tert-butylphenyl)-2,3,8-trimethyltetracene (PubChem CID 162426404) has the molecular formula C61H66 and a molecular weight of 799.20 g/mol. Its IUPAC name is 5,6,11,12-tetrakis(4-tert-butylphenyl)-2,3,8-trimethyltetracene.
| Compound Name | 5,6,11,12-tetrakis(4-tert-butylphenyl)-2,3,8-trimethyltetracene |
|---|---|
| PubChem CID | 162426404 |
| Molecular Formula | C61H66 |
| Molecular Weight | 799.20 g/mol |
| Exact Mass | 798.52 |
| IUPAC Name | 5,6,11,12-tetrakis(4-tert-butylphenyl)-2,3,8-trimethyltetracene |
| SMILES | Cc1ccc2c(-c3ccc(C(C)(C)C)cc3)c3c(-c4ccc(C(C)(C)C)cc4)c4cc(C)c(C)cc4c(-c4ccc(C(C)(C)C)cc4)c3c(-c3ccc(C(C)(C)C)cc3)c2c1 |
| InChI | InChI=1S/C61H66/c1-37-16-33-48-49(34-37)53(41-19-27-45(28-20-41)59(7,8)9)57-55(43-23-31-47(32-24-43)61(13,14)15)51-36-39(3)38(2)35-50(51)54(42-21-29-46(30-22-42)60(10,11)12)56(57)52(48)40-17-25-44(26-18-40)58(4,5)6/h16-36H,1-15H3 |
| InChIKey | MEDVXSCVZVNSJC-UHFFFAOYSA-N |
| XLogP | 17.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.20 |
| LogP ≤ 5 | 17.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|