C58H60 — CID 22935008
5,6,11,12-tetrakis(4-tert-butylphenyl)tetracene (PubChem CID 22935008) has the molecular formula C58H60 and a molecular weight of 757.12 g/mol. Its IUPAC name is 5,6,11,12-tetrakis(4-tert-butylphenyl)tetracene.
| Compound Name | 5,6,11,12-tetrakis(4-tert-butylphenyl)tetracene |
|---|---|
| PubChem CID | 22935008 |
| Molecular Formula | C58H60 |
| Molecular Weight | 757.12 g/mol |
| Exact Mass | 756.47 |
| IUPAC Name | 5,6,11,12-tetrakis(4-tert-butylphenyl)tetracene |
| SMILES | CC(C)(C)c1ccc(-c2c3ccccc3c(-c3ccc(C(C)(C)C)cc3)c3c(-c4ccc(C(C)(C)C)cc4)c4ccccc4c(-c4ccc(C(C)(C)C)cc4)c23)cc1 |
| InChI | InChI=1S/C58H60/c1-55(2,3)41-29-21-37(22-30-41)49-45-17-13-14-18-46(45)51(39-25-33-43(34-26-39)57(7,8)9)54-52(40-27-35-44(36-28-40)58(10,11)12)48-20-16-15-19-47(48)50(53(49)54)38-23-31-42(32-24-38)56(4,5)6/h13-36H,1-12H3 |
| InChIKey | ZINJLDDVBPVWAQ-UHFFFAOYSA-N |
| XLogP | 17.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.12 |
| LogP ≤ 5 | 17.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|