C30H32 — CID 123481845
1,4-bis(4-tert-butylphenyl)naphthalene (PubChem CID 123481845) has the molecular formula C30H32 and a molecular weight of 392.59 g/mol. Its IUPAC name is 1,4-bis(4-tert-butylphenyl)naphthalene.
| Compound Name | 1,4-bis(4-tert-butylphenyl)naphthalene |
|---|---|
| PubChem CID | 123481845 |
| Molecular Formula | C30H32 |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | 1,4-bis(4-tert-butylphenyl)naphthalene |
| SMILES | CC(C)(C)c1ccc(-c2ccc(-c3ccc(C(C)(C)C)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C30H32/c1-29(2,3)23-15-11-21(12-16-23)25-19-20-26(28-10-8-7-9-27(25)28)22-13-17-24(18-14-22)30(4,5)6/h7-20H,1-6H3 |
| InChIKey | ZFVGBTKHVJYFQC-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |