C40H38 — CID 175769843
3-(4-tert-butylphenyl)-1-[3-(4-tert-butylphenyl)naphthalen-1-yl]naphthalene (PubChem CID 175769843) has the molecular formula C40H38 and a molecular weight of 518.74 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-1-[3-(4-tert-butylphenyl)naphthalen-1-yl]naphthalene.
| Compound Name | 3-(4-tert-butylphenyl)-1-[3-(4-tert-butylphenyl)naphthalen-1-yl]naphthalene |
|---|---|
| PubChem CID | 175769843 |
| Molecular Formula | C40H38 |
| Molecular Weight | 518.74 g/mol |
| Exact Mass | 518.30 |
| IUPAC Name | 3-(4-tert-butylphenyl)-1-[3-(4-tert-butylphenyl)naphthalen-1-yl]naphthalene |
| SMILES | CC(C)(C)c1ccc(-c2cc(-c3cc(-c4ccc(C(C)(C)C)cc4)cc4ccccc34)c3ccccc3c2)cc1 |
| InChI | InChI=1S/C40H38/c1-39(2,3)33-19-15-27(16-20-33)31-23-29-11-7-9-13-35(29)37(25-31)38-26-32(24-30-12-8-10-14-36(30)38)28-17-21-34(22-18-28)40(4,5)6/h7-26H,1-6H3 |
| InChIKey | BZIFBJMAWBEDIT-UHFFFAOYSA-N |
| XLogP | 11.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.74 |
| LogP ≤ 5 | 11.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |