C42H39NS — CID 166689734
3-tert-butyl-10-[4-[3-(4-tert-butylphenyl)naphthalen-1-yl]phenyl]phenothiazine (PubChem CID 166689734) has the molecular formula C42H39NS and a molecular weight of 589.85 g/mol. Its IUPAC name is 3-tert-butyl-10-[4-[3-(4-tert-butylphenyl)naphthalen-1-yl]phenyl]phenothiazine.
| Compound Name | 3-tert-butyl-10-[4-[3-(4-tert-butylphenyl)naphthalen-1-yl]phenyl]phenothiazine |
|---|---|
| PubChem CID | 166689734 |
| Molecular Formula | C42H39NS |
| Molecular Weight | 589.85 g/mol |
| Exact Mass | 589.28 |
| IUPAC Name | 3-tert-butyl-10-[4-[3-(4-tert-butylphenyl)naphthalen-1-yl]phenyl]phenothiazine |
| SMILES | CC(C)(C)c1ccc(-c2cc(-c3ccc(N4c5ccccc5Sc5cc(C(C)(C)C)ccc54)cc3)c3ccccc3c2)cc1 |
| InChI | InChI=1S/C42H39NS/c1-41(2,3)32-19-15-28(16-20-32)31-25-30-11-7-8-12-35(30)36(26-31)29-17-22-34(23-18-29)43-37-13-9-10-14-39(37)44-40-27-33(42(4,5)6)21-24-38(40)43/h7-27H,1-6H3 |
| InChIKey | UGCTXRJGTHYBPG-UHFFFAOYSA-N |
| XLogP | 12.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.85 |
| LogP ≤ 5 | 12.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |