C30H25N3S2 — CID 146533656
10-(4-tert-butylphenyl)-2-(5-phenyl-1,2,4-thiadiazol-3-yl)phenothiazine (PubChem CID 146533656) has the molecular formula C30H25N3S2 and a molecular weight of 491.69 g/mol. Its IUPAC name is 10-(4-tert-butylphenyl)-2-(5-phenyl-1,2,4-thiadiazol-3-yl)phenothiazine.
| Compound Name | 10-(4-tert-butylphenyl)-2-(5-phenyl-1,2,4-thiadiazol-3-yl)phenothiazine |
|---|---|
| PubChem CID | 146533656 |
| Molecular Formula | C30H25N3S2 |
| Molecular Weight | 491.69 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | 10-(4-tert-butylphenyl)-2-(5-phenyl-1,2,4-thiadiazol-3-yl)phenothiazine |
| SMILES | CC(C)(C)c1ccc(N2c3ccccc3Sc3ccc(-c4nsc(-c5ccccc5)n4)cc32)cc1 |
| InChI | InChI=1S/C30H25N3S2/c1-30(2,3)22-14-16-23(17-15-22)33-24-11-7-8-12-26(24)34-27-18-13-21(19-25(27)33)28-31-29(35-32-28)20-9-5-4-6-10-20/h4-19H,1-3H3 |
| InChIKey | ZEJVIVFICHZOJU-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.69 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |