C30H25N3S — CID 146533817
3-(4-tert-butylphenyl)-5-(4-carbazol-9-ylphenyl)-1,2,4-thiadiazole (PubChem CID 146533817) has the molecular formula C30H25N3S and a molecular weight of 459.62 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-5-(4-carbazol-9-ylphenyl)-1,2,4-thiadiazole.
| Compound Name | 3-(4-tert-butylphenyl)-5-(4-carbazol-9-ylphenyl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 146533817 |
| Molecular Formula | C30H25N3S |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 3-(4-tert-butylphenyl)-5-(4-carbazol-9-ylphenyl)-1,2,4-thiadiazole |
| SMILES | CC(C)(C)c1ccc(-c2nsc(-c3ccc(-n4c5ccccc5c5ccccc54)cc3)n2)cc1 |
| InChI | InChI=1S/C30H25N3S/c1-30(2,3)22-16-12-20(13-17-22)28-31-29(34-32-28)21-14-18-23(19-15-21)33-26-10-6-4-8-24(26)25-9-5-7-11-27(25)33/h4-19H,1-3H3 |
| InChIKey | RTIMASFMRQNFGF-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |