C56H44N4S — CID 146534120
3,5-bis[9,9-dimethyl-10-(4-phenylphenyl)acridin-2-yl]-1,2,4-thiadiazole (PubChem CID 146534120) has the molecular formula C56H44N4S and a molecular weight of 805.06 g/mol. Its IUPAC name is 3,5-bis[9,9-dimethyl-10-(4-phenylphenyl)acridin-2-yl]-1,2,4-thiadiazole.
| Compound Name | 3,5-bis[9,9-dimethyl-10-(4-phenylphenyl)acridin-2-yl]-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 146534120 |
| Molecular Formula | C56H44N4S |
| Molecular Weight | 805.06 g/mol |
| Exact Mass | 804.33 |
| IUPAC Name | 3,5-bis[9,9-dimethyl-10-(4-phenylphenyl)acridin-2-yl]-1,2,4-thiadiazole |
| SMILES | CC1(C)c2ccccc2N(c2ccc(-c3ccccc3)cc2)c2ccc(-c3nsc(-c4ccc5c(c4)C(C)(C)c4ccccc4N5c4ccc(-c5ccccc5)cc4)n3)cc21 |
| InChI | InChI=1S/C56H44N4S/c1-55(2)45-19-11-13-21-49(45)59(43-29-23-39(24-30-43)37-15-7-5-8-16-37)51-33-27-41(35-47(51)55)53-57-54(61-58-53)42-28-34-52-48(36-42)56(3,4)46-20-12-14-22-50(46)60(52)44-31-25-40(26-32-44)38-17-9-6-10-18-38/h5-36H,1-4H3 |
| InChIKey | BWLLQHCHLMOBHG-UHFFFAOYSA-N |
| XLogP | 15.42 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.06 |
| LogP ≤ 5 | 15.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |