C48H36N4 — CID 118472949
2-[4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-9,9-dimethyl-10-phenylacridine (PubChem CID 118472949) has the molecular formula C48H36N4 and a molecular weight of 668.84 g/mol. Its IUPAC name is 2-[4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-9,9-dimethyl-10-phenylacridine.
| Compound Name | 2-[4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-9,9-dimethyl-10-phenylacridine |
|---|---|
| PubChem CID | 118472949 |
| Molecular Formula | C48H36N4 |
| Molecular Weight | 668.84 g/mol |
| Exact Mass | 668.29 |
| IUPAC Name | 2-[4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-9,9-dimethyl-10-phenylacridine |
| SMILES | CC1(C)c2ccccc2N(c2ccccc2)c2ccc(-c3ccc(-c4cccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c4)cc3)cc21 |
| InChI | InChI=1S/C48H36N4/c1-48(2)41-23-12-13-24-43(41)52(40-21-10-5-11-22-40)44-30-29-38(32-42(44)48)34-27-25-33(26-28-34)37-19-14-20-39(31-37)47-50-45(35-15-6-3-7-16-35)49-46(51-47)36-17-8-4-9-18-36/h3-32H,1-2H3 |
| InChIKey | JEYUWHUWEWOHLW-UHFFFAOYSA-N |
| XLogP | 12.32 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.84 |
| LogP ≤ 5 | 12.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |