C43H34N4 — CID 89183043
4-[10-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-9,9-dimethylacridin-2-yl]aniline (PubChem CID 89183043) has the molecular formula C43H34N4 and a molecular weight of 606.77 g/mol. Its IUPAC name is 4-[10-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-9,9-dimethylacridin-2-yl]aniline.
| Compound Name | 4-[10-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-9,9-dimethylacridin-2-yl]aniline |
|---|---|
| PubChem CID | 89183043 |
| Molecular Formula | C43H34N4 |
| Molecular Weight | 606.77 g/mol |
| Exact Mass | 606.28 |
| IUPAC Name | 4-[10-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-9,9-dimethylacridin-2-yl]aniline |
| SMILES | CC1(C)c2ccccc2N(c2cccc(-c3nc(-c4ccccc4)cc(-c4ccccc4)n3)c2)c2ccc(-c3ccc(N)cc3)cc21 |
| InChI | InChI=1S/C43H34N4/c1-43(2)36-18-9-10-19-40(36)47(41-25-22-32(27-37(41)43)29-20-23-34(44)24-21-29)35-17-11-16-33(26-35)42-45-38(30-12-5-3-6-13-30)28-39(46-42)31-14-7-4-8-15-31/h3-28H,44H2,1-2H3 |
| InChIKey | RERAKMXGLIBYSN-UHFFFAOYSA-N |
| XLogP | 10.84 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.77 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|