C52H41N3 — CID 71007179
2-[7-(2,6-diphenylpyrimidin-4-yl)-9,9-dimethylfluoren-2-yl]-9,9-dimethyl-10-phenylacridine (PubChem CID 71007179) has the molecular formula C52H41N3 and a molecular weight of 707.92 g/mol. Its IUPAC name is 2-[7-(2,6-diphenylpyrimidin-4-yl)-9,9-dimethylfluoren-2-yl]-9,9-dimethyl-10-phenylacridine.
| Compound Name | 2-[7-(2,6-diphenylpyrimidin-4-yl)-9,9-dimethylfluoren-2-yl]-9,9-dimethyl-10-phenylacridine |
|---|---|
| PubChem CID | 71007179 |
| Molecular Formula | C52H41N3 |
| Molecular Weight | 707.92 g/mol |
| Exact Mass | 707.33 |
| IUPAC Name | 2-[7-(2,6-diphenylpyrimidin-4-yl)-9,9-dimethylfluoren-2-yl]-9,9-dimethyl-10-phenylacridine |
| SMILES | CC1(C)c2cc(-c3ccc4c(c3)C(C)(C)c3ccccc3N4c3ccccc3)ccc2-c2ccc(-c3cc(-c4ccccc4)nc(-c4ccccc4)n3)cc21 |
| InChI | InChI=1S/C52H41N3/c1-51(2)42-22-14-15-23-48(42)55(39-20-12-7-13-21-39)49-29-26-37(31-45(49)51)36-24-27-40-41-28-25-38(32-44(41)52(3,4)43(40)30-36)47-33-46(34-16-8-5-9-17-34)53-50(54-47)35-18-10-6-11-19-35/h5-33H,1-4H3 |
| InChIKey | PDJKVNPTLZEVQI-UHFFFAOYSA-N |
| XLogP | 13.56 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.92 |
| LogP ≤ 5 | 13.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |