C29H23N3S — CID 121245061
3-[4-(9,9-dimethylacridin-10-yl)phenyl]-5-phenyl-1,2,4-thiadiazole (PubChem CID 121245061) has the molecular formula C29H23N3S and a molecular weight of 445.59 g/mol. Its IUPAC name is 3-[4-(9,9-dimethylacridin-10-yl)phenyl]-5-phenyl-1,2,4-thiadiazole.
| Compound Name | 3-[4-(9,9-dimethylacridin-10-yl)phenyl]-5-phenyl-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 121245061 |
| Molecular Formula | C29H23N3S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 3-[4-(9,9-dimethylacridin-10-yl)phenyl]-5-phenyl-1,2,4-thiadiazole |
| SMILES | CC1(C)c2ccccc2N(c2ccc(-c3nsc(-c4ccccc4)n3)cc2)c2ccccc21 |
| InChI | InChI=1S/C29H23N3S/c1-29(2)23-12-6-8-14-25(23)32(26-15-9-7-13-24(26)29)22-18-16-20(17-19-22)27-30-28(33-31-27)21-10-4-3-5-11-21/h3-19H,1-2H3 |
| InChIKey | WZXLPVPQISBIJM-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |