C35H28N4 — CID 121244948
10-[4-(1,5-diphenyl-1,2,4-triazol-3-yl)phenyl]-9,9-dimethylacridine (PubChem CID 121244948) has the molecular formula C35H28N4 and a molecular weight of 504.64 g/mol. Its IUPAC name is 10-[4-(1,5-diphenyl-1,2,4-triazol-3-yl)phenyl]-9,9-dimethylacridine.
| Compound Name | 10-[4-(1,5-diphenyl-1,2,4-triazol-3-yl)phenyl]-9,9-dimethylacridine |
|---|---|
| PubChem CID | 121244948 |
| Molecular Formula | C35H28N4 |
| Molecular Weight | 504.64 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | 10-[4-(1,5-diphenyl-1,2,4-triazol-3-yl)phenyl]-9,9-dimethylacridine |
| SMILES | CC1(C)c2ccccc2N(c2ccc(-c3nc(-c4ccccc4)n(-c4ccccc4)n3)cc2)c2ccccc21 |
| InChI | InChI=1S/C35H28N4/c1-35(2)29-17-9-11-19-31(29)38(32-20-12-10-18-30(32)35)27-23-21-25(22-24-27)33-36-34(26-13-5-3-6-14-26)39(37-33)28-15-7-4-8-16-28/h3-24H,1-2H3 |
| InChIKey | LNCXDVQIHXPENS-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.64 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |