C34H27N5 — CID 121244864
5-[4-(1,5-diphenyl-1,2,4-triazol-3-yl)phenyl]-10-ethylphenazine (PubChem CID 121244864) has the molecular formula C34H27N5 and a molecular weight of 505.63 g/mol. Its IUPAC name is 5-[4-(1,5-diphenyl-1,2,4-triazol-3-yl)phenyl]-10-ethylphenazine.
| Compound Name | 5-[4-(1,5-diphenyl-1,2,4-triazol-3-yl)phenyl]-10-ethylphenazine |
|---|---|
| PubChem CID | 121244864 |
| Molecular Formula | C34H27N5 |
| Molecular Weight | 505.63 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | 5-[4-(1,5-diphenyl-1,2,4-triazol-3-yl)phenyl]-10-ethylphenazine |
| SMILES | CCN1c2ccccc2N(c2ccc(-c3nc(-c4ccccc4)n(-c4ccccc4)n3)cc2)c2ccccc21 |
| InChI | InChI=1S/C34H27N5/c1-2-37-29-17-9-11-19-31(29)38(32-20-12-10-18-30(32)37)27-23-21-25(22-24-27)33-35-34(26-13-5-3-6-14-26)39(36-33)28-15-7-4-8-16-28/h3-24H,2H2,1H3 |
| InChIKey | QCWTVBNNVLFVCY-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.63 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |