C33H26N4 — CID 59500022
4-[5-(4-methylphenyl)-3-phenyl-1,2,4-triazol-1-yl]-N,N-diphenylaniline (PubChem CID 59500022) has the molecular formula C33H26N4 and a molecular weight of 478.60 g/mol. Its IUPAC name is 4-[5-(4-methylphenyl)-3-phenyl-1,2,4-triazol-1-yl]-N,N-diphenylaniline.
| Compound Name | 4-[5-(4-methylphenyl)-3-phenyl-1,2,4-triazol-1-yl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 59500022 |
| Molecular Formula | C33H26N4 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | 4-[5-(4-methylphenyl)-3-phenyl-1,2,4-triazol-1-yl]-N,N-diphenylaniline |
| SMILES | Cc1ccc(-c2nc(-c3ccccc3)nn2-c2ccc(N(c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C33H26N4/c1-25-17-19-27(20-18-25)33-34-32(26-11-5-2-6-12-26)35-37(33)31-23-21-30(22-24-31)36(28-13-7-3-8-14-28)29-15-9-4-10-16-29/h2-24H,1H3 |
| InChIKey | WHOHOHMLYWBVJG-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |