C38H28N4 — CID 59499896
N,N-diphenyl-4-[3-phenyl-5-(3-phenylphenyl)-1,2,4-triazol-1-yl]aniline (PubChem CID 59499896) has the molecular formula C38H28N4 and a molecular weight of 540.67 g/mol. Its IUPAC name is N,N-diphenyl-4-[3-phenyl-5-(3-phenylphenyl)-1,2,4-triazol-1-yl]aniline.
| Compound Name | N,N-diphenyl-4-[3-phenyl-5-(3-phenylphenyl)-1,2,4-triazol-1-yl]aniline |
|---|---|
| PubChem CID | 59499896 |
| Molecular Formula | C38H28N4 |
| Molecular Weight | 540.67 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | N,N-diphenyl-4-[3-phenyl-5-(3-phenylphenyl)-1,2,4-triazol-1-yl]aniline |
| SMILES | c1ccc(-c2cccc(-c3nc(-c4ccccc4)nn3-c3ccc(N(c4ccccc4)c4ccccc4)cc3)c2)cc1 |
| InChI | InChI=1S/C38H28N4/c1-5-14-29(15-6-1)31-18-13-19-32(28-31)38-39-37(30-16-7-2-8-17-30)40-42(38)36-26-24-35(25-27-36)41(33-20-9-3-10-21-33)34-22-11-4-12-23-34/h1-28H |
| InChIKey | PVWZYIYVVHPVCQ-UHFFFAOYSA-N |
| XLogP | 9.74 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.67 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |