C42H30N6 — CID 89201714
1-[4-[(E)-2-[4-(3,5-diphenyl-1,2,4-triazol-1-yl)phenyl]ethenyl]phenyl]-3,5-diphenyl-1,2,4-triazole (PubChem CID 89201714) has the molecular formula C42H30N6 and a molecular weight of 618.74 g/mol. Its IUPAC name is 1-[4-[(E)-2-[4-(3,5-diphenyl-1,2,4-triazol-1-yl)phenyl]ethenyl]phenyl]-3,5-diphenyl-1,2,4-triazole.
| Compound Name | 1-[4-[(E)-2-[4-(3,5-diphenyl-1,2,4-triazol-1-yl)phenyl]ethenyl]phenyl]-3,5-diphenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 89201714 |
| Molecular Formula | C42H30N6 |
| Molecular Weight | 618.74 g/mol |
| Exact Mass | 618.25 |
| IUPAC Name | 1-[4-[(E)-2-[4-(3,5-diphenyl-1,2,4-triazol-1-yl)phenyl]ethenyl]phenyl]-3,5-diphenyl-1,2,4-triazole |
| SMILES | C(=C/c1ccc(-n2nc(-c3ccccc3)nc2-c2ccccc2)cc1)\c1ccc(-n2nc(-c3ccccc3)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C42H30N6/c1-5-13-33(14-6-1)39-43-41(35-17-9-3-10-18-35)47(45-39)37-27-23-31(24-28-37)21-22-32-25-29-38(30-26-32)48-42(36-19-11-4-12-20-36)44-40(46-48)34-15-7-2-8-16-34/h1-30H/b22-21+ |
| InChIKey | RLCNRTKPPKLBGJ-QURGRASLSA-N |
| XLogP | 9.69 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.74 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|