C19H14N4 — CID 102454692
2-(2,5-diphenyl-1,2,4-triazol-3-yl)pyridine (PubChem CID 102454692) has the molecular formula C19H14N4 and a molecular weight of 298.35 g/mol. Its IUPAC name is 2-(2,5-diphenyl-1,2,4-triazol-3-yl)pyridine.
| Compound Name | 2-(2,5-diphenyl-1,2,4-triazol-3-yl)pyridine |
|---|---|
| PubChem CID | 102454692 |
| Molecular Formula | C19H14N4 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 2-(2,5-diphenyl-1,2,4-triazol-3-yl)pyridine |
| SMILES | c1ccc(-c2nc(-c3ccccn3)n(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C19H14N4/c1-3-9-15(10-4-1)18-21-19(17-13-7-8-14-20-17)23(22-18)16-11-5-2-6-12-16/h1-14H |
| InChIKey | FBFJCFAGBPORCQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |