C26H20N6 — CID 11165952
6,10-dimethyl-4,12-diphenyl-8-pyridin-2-yl-2,4,5,11,12-pentazatricyclo[7.3.0.03,7]dodeca-1,3(7),5,8,10-pentaene (PubChem CID 11165952) has the molecular formula C26H20N6 and a molecular weight of 416.49 g/mol. Its IUPAC name is 6,10-dimethyl-4,12-diphenyl-8-pyridin-2-yl-2,4,5,11,12-pentazatricyclo[7.3.0.03,7]dodeca-1,3(7),5,8,10-pentaene.
| Compound Name | 6,10-dimethyl-4,12-diphenyl-8-pyridin-2-yl-2,4,5,11,12-pentazatricyclo[7.3.0.03,7]dodeca-1,3(7),5,8,10-pentaene |
|---|---|
| PubChem CID | 11165952 |
| Molecular Formula | C26H20N6 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 6,10-dimethyl-4,12-diphenyl-8-pyridin-2-yl-2,4,5,11,12-pentazatricyclo[7.3.0.03,7]dodeca-1,3(7),5,8,10-pentaene |
| SMILES | Cc1nn(-c2ccccc2)c2nc3c(c(C)nn3-c3ccccc3)c(-c3ccccn3)c12 |
| InChI | InChI=1S/C26H20N6/c1-17-22-24(21-15-9-10-16-27-21)23-18(2)30-32(20-13-7-4-8-14-20)26(23)28-25(22)31(29-17)19-11-5-3-6-12-19/h3-16H,1-2H3 |
| InChIKey | ZNMVBTMSKYTPFP-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |