C33H24N4O — CID 177409101
(E)-(3,10-dimethyl-5,15-diphenyl-4,5,7,14-tetrazatetracyclo[7.6.1.02,6.013,16]hexadeca-1,3,6,9,11,13(16),14-heptaen-8-ylidene)-phenylmethanol (PubChem CID 177409101) has the molecular formula C33H24N4O and a molecular weight of 492.58 g/mol. Its IUPAC name is (E)-(3,10-dimethyl-5,15-diphenyl-4,5,7,14-tetrazatetracyclo[7.6.1.02,6.013,16]hexadeca-1,3,6,9,11,13(16),14-heptaen-8-ylidene)-phenylmethanol.
| Compound Name | (E)-(3,10-dimethyl-5,15-diphenyl-4,5,7,14-tetrazatetracyclo[7.6.1.02,6.013,16]hexadeca-1,3,6,9,11,13(16),14-heptaen-8-ylidene)-phenylmethanol |
|---|---|
| PubChem CID | 177409101 |
| Molecular Formula | C33H24N4O |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | (E)-(3,10-dimethyl-5,15-diphenyl-4,5,7,14-tetrazatetracyclo[7.6.1.02,6.013,16]hexadeca-1,3,6,9,11,13(16),14-heptaen-8-ylidene)-phenylmethanol |
| SMILES | Cc1ccc2nc(-c3ccccc3)c3c4c(C)nn(-c5ccccc5)c4n/c(=C(/O)c4ccccc4)c1c2-3 |
| InChI | InChI=1S/C33H24N4O/c1-20-18-19-25-28-26(20)31(32(38)23-14-8-4-9-15-23)35-33-27(21(2)36-37(33)24-16-10-5-11-17-24)29(28)30(34-25)22-12-6-3-7-13-22/h3-19,38H,1-2H3/b32-31+ |
| InChIKey | WIWPAESBFDBZTL-QNEJGDQOSA-N |
| XLogP | 6.79 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |