C27H17N5O — CID 156672541
2-[5-isocyano-6-(4-isocyanophenyl)-3-methyl-1-phenylpyrazolo[3,4-b]pyridin-4-yl]phenol (PubChem CID 156672541) has the molecular formula C27H17N5O and a molecular weight of 427.47 g/mol. Its IUPAC name is 2-[5-isocyano-6-(4-isocyanophenyl)-3-methyl-1-phenylpyrazolo[3,4-b]pyridin-4-yl]phenol.
| Compound Name | 2-[5-isocyano-6-(4-isocyanophenyl)-3-methyl-1-phenylpyrazolo[3,4-b]pyridin-4-yl]phenol |
|---|---|
| PubChem CID | 156672541 |
| Molecular Formula | C27H17N5O |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 2-[5-isocyano-6-(4-isocyanophenyl)-3-methyl-1-phenylpyrazolo[3,4-b]pyridin-4-yl]phenol |
| SMILES | [C-]#[N+]c1ccc(-c2nc3c(c(C)nn3-c3ccccc3)c(-c3ccccc3O)c2[N+]#[C-])cc1 |
| InChI | InChI=1S/C27H17N5O/c1-17-23-24(21-11-7-8-12-22(21)33)26(29-3)25(18-13-15-19(28-2)16-14-18)30-27(23)32(31-17)20-9-5-4-6-10-20/h4-16,33H,1H3 |
| InChIKey | IZHWMCVOZIVPPO-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 59.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|