C20H18N6OS — CID 10862088
[4-(4-methoxyphenyl)-3-methyl-1-phenylpyrazolo[3,4-d]pyrimidin-6-yl]thiourea (PubChem CID 10862088) has the molecular formula C20H18N6OS and a molecular weight of 390.47 g/mol. Its IUPAC name is [4-(4-methoxyphenyl)-3-methyl-1-phenylpyrazolo[3,4-d]pyrimidin-6-yl]thiourea.
| Compound Name | [4-(4-methoxyphenyl)-3-methyl-1-phenylpyrazolo[3,4-d]pyrimidin-6-yl]thiourea |
|---|---|
| PubChem CID | 10862088 |
| Molecular Formula | C20H18N6OS |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | [4-(4-methoxyphenyl)-3-methyl-1-phenylpyrazolo[3,4-d]pyrimidin-6-yl]thiourea |
| SMILES | COc1ccc(-c2nc(NC(N)=S)nc3c2c(C)nn3-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H18N6OS/c1-12-16-17(13-8-10-15(27-2)11-9-13)22-20(24-19(21)28)23-18(16)26(25-12)14-6-4-3-5-7-14/h3-11H,1-2H3,(H3,21,22,23,24,28) |
| InChIKey | PPDWYIWTWQUGPN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|