C18H15N5 — CID 110171361
6-methyl-1,4-diphenylpyrazolo[3,4-d]pyrimidin-3-amine (PubChem CID 110171361) has the molecular formula C18H15N5 and a molecular weight of 301.35 g/mol. Its IUPAC name is 6-methyl-1,4-diphenylpyrazolo[3,4-d]pyrimidin-3-amine.
| Compound Name | 6-methyl-1,4-diphenylpyrazolo[3,4-d]pyrimidin-3-amine |
|---|---|
| PubChem CID | 110171361 |
| Molecular Formula | C18H15N5 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 6-methyl-1,4-diphenylpyrazolo[3,4-d]pyrimidin-3-amine |
| SMILES | Cc1nc(-c2ccccc2)c2c(N)nn(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C18H15N5/c1-12-20-16(13-8-4-2-5-9-13)15-17(19)22-23(18(15)21-12)14-10-6-3-7-11-14/h2-11H,1H3,(H2,19,22) |
| InChIKey | PUXYOTUJSIDOOJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |