C18H14N4 — CID 57380816
5-methyl-1,3-diphenylpyrazolo[4,3-d]pyrimidine (PubChem CID 57380816) has the molecular formula C18H14N4 and a molecular weight of 286.34 g/mol. Its IUPAC name is 5-methyl-1,3-diphenylpyrazolo[4,3-d]pyrimidine.
| Compound Name | 5-methyl-1,3-diphenylpyrazolo[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 57380816 |
| Molecular Formula | C18H14N4 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 5-methyl-1,3-diphenylpyrazolo[4,3-d]pyrimidine |
| SMILES | Cc1ncc2c(n1)c(-c1ccccc1)nn2-c1ccccc1 |
| InChI | InChI=1S/C18H14N4/c1-13-19-12-16-18(20-13)17(14-8-4-2-5-9-14)21-22(16)15-10-6-3-7-11-15/h2-12H,1H3 |
| InChIKey | ZJPVBOLYBWAROP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |