C16H13ClN2 — CID 104847504
5-chloro-4-methyl-1,3-diphenylpyrazole (PubChem CID 104847504) has the molecular formula C16H13ClN2 and a molecular weight of 268.75 g/mol. Its IUPAC name is 5-chloro-4-methyl-1,3-diphenylpyrazole.
| Compound Name | 5-chloro-4-methyl-1,3-diphenylpyrazole |
|---|---|
| PubChem CID | 104847504 |
| Molecular Formula | C16H13ClN2 |
| Molecular Weight | 268.75 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 5-chloro-4-methyl-1,3-diphenylpyrazole |
| SMILES | Cc1c(-c2ccccc2)nn(-c2ccccc2)c1Cl |
| InChI | InChI=1S/C16H13ClN2/c1-12-15(13-8-4-2-5-9-13)18-19(16(12)17)14-10-6-3-7-11-14/h2-11H,1H3 |
| InChIKey | JGZLRATYLDYSFC-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.75 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |