C23H19N5O2 — CID 155808502
8-(4-methoxyphenyl)-6,12-dimethyl-4-phenyl-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1(9),2,5,7,12-pentaen-10-one (PubChem CID 155808502) has the molecular formula C23H19N5O2 and a molecular weight of 397.44 g/mol. Its IUPAC name is 8-(4-methoxyphenyl)-6,12-dimethyl-4-phenyl-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1(9),2,5,7,12-pentaen-10-one.
| Compound Name | 8-(4-methoxyphenyl)-6,12-dimethyl-4-phenyl-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1(9),2,5,7,12-pentaen-10-one |
|---|---|
| PubChem CID | 155808502 |
| Molecular Formula | C23H19N5O2 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 8-(4-methoxyphenyl)-6,12-dimethyl-4-phenyl-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1(9),2,5,7,12-pentaen-10-one |
| SMILES | COc1ccc(-c2c3c(C)nn(-c4ccccc4)c3nc3nc(C)[nH]c(=O)c23)cc1 |
| InChI | InChI=1S/C23H19N5O2/c1-13-18-19(15-9-11-17(30-3)12-10-15)20-21(24-14(2)25-23(20)29)26-22(18)28(27-13)16-7-5-4-6-8-16/h4-12H,1-3H3,(H,24,25,26,29) |
| InChIKey | BYXLXKQKLVJYLO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |