C26H23N5 — CID 122377737
6-methyl-8-(4-methylphenyl)-4-phenyl-2,4,5,16-tetrazatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),2,5,7,9,11(15)-hexaen-10-amine (PubChem CID 122377737) has the molecular formula C26H23N5 and a molecular weight of 405.51 g/mol. Its IUPAC name is 6-methyl-8-(4-methylphenyl)-4-phenyl-2,4,5,16-tetrazatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),2,5,7,9,11(15)-hexaen-10-amine.
| Compound Name | 6-methyl-8-(4-methylphenyl)-4-phenyl-2,4,5,16-tetrazatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),2,5,7,9,11(15)-hexaen-10-amine |
|---|---|
| PubChem CID | 122377737 |
| Molecular Formula | C26H23N5 |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 6-methyl-8-(4-methylphenyl)-4-phenyl-2,4,5,16-tetrazatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),2,5,7,9,11(15)-hexaen-10-amine |
| SMILES | Cc1ccc(-c2c3c(N)c4c(nc3nc3c2c(C)nn3-c2ccccc2)CCC4)cc1 |
| InChI | InChI=1S/C26H23N5/c1-15-11-13-17(14-12-15)22-21-16(2)30-31(18-7-4-3-5-8-18)26(21)29-25-23(22)24(27)19-9-6-10-20(19)28-25/h3-5,7-8,11-14H,6,9-10H2,1-2H3,(H2,27,28,29) |
| InChIKey | HVHHMLUWRJLVHA-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |