C23H20N4O2 — CID 139233397
3-methyl-4-(4-nitrophenyl)-1-phenyl-5,6,7,8-tetrahydropyrazolo[3,4-b]quinoline (PubChem CID 139233397) has the molecular formula C23H20N4O2 and a molecular weight of 384.44 g/mol. Its IUPAC name is 3-methyl-4-(4-nitrophenyl)-1-phenyl-5,6,7,8-tetrahydropyrazolo[3,4-b]quinoline.
| Compound Name | 3-methyl-4-(4-nitrophenyl)-1-phenyl-5,6,7,8-tetrahydropyrazolo[3,4-b]quinoline |
|---|---|
| PubChem CID | 139233397 |
| Molecular Formula | C23H20N4O2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 3-methyl-4-(4-nitrophenyl)-1-phenyl-5,6,7,8-tetrahydropyrazolo[3,4-b]quinoline |
| SMILES | Cc1nn(-c2ccccc2)c2nc3c(c(-c4ccc([N+](=O)[O-])cc4)c12)CCCC3 |
| InChI | InChI=1S/C23H20N4O2/c1-15-21-22(16-11-13-18(14-12-16)27(28)29)19-9-5-6-10-20(19)24-23(21)26(25-15)17-7-3-2-4-8-17/h2-4,7-8,11-14H,5-6,9-10H2,1H3 |
| InChIKey | UQUSVODNWNPHKP-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|