C35H27N3O3 — CID 150606189
2-[5-ethyl-4-(4-methoxyphenyl)-3-methyl-1-phenylpyrazolo[5,4-b]pyridin-6-yl]benzo[f]chromen-3-one (PubChem CID 150606189) has the molecular formula C35H27N3O3 and a molecular weight of 537.62 g/mol. Its IUPAC name is 2-[5-ethyl-4-(4-methoxyphenyl)-3-methyl-1-phenylpyrazolo[5,4-b]pyridin-6-yl]benzo[f]chromen-3-one.
| Compound Name | 2-[5-ethyl-4-(4-methoxyphenyl)-3-methyl-1-phenylpyrazolo[5,4-b]pyridin-6-yl]benzo[f]chromen-3-one |
|---|---|
| PubChem CID | 150606189 |
| Molecular Formula | C35H27N3O3 |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | 2-[5-ethyl-4-(4-methoxyphenyl)-3-methyl-1-phenylpyrazolo[5,4-b]pyridin-6-yl]benzo[f]chromen-3-one |
| SMILES | CCc1c(-c2cc3c(ccc4ccccc43)oc2=O)nc2c(c(C)nn2-c2ccccc2)c1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C35H27N3O3/c1-4-26-32(23-14-17-25(40-3)18-15-23)31-21(2)37-38(24-11-6-5-7-12-24)34(31)36-33(26)29-20-28-27-13-9-8-10-22(27)16-19-30(28)41-35(29)39/h5-20H,4H2,1-3H3 |
| InChIKey | ISXRYHOIBHTMKA-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 70.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|